C16H9FN4OS3 — CID 10452880
N-[5-(6-fluoroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 10452880) has the molecular formula C16H9FN4OS3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[5-(6-fluoroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(6-fluoroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10452880 |
| Molecular Formula | C16H9FN4OS3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | N-[5-(6-fluoroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(Sc2ccnc3ccc(F)cc23)s1)c1cccs1 |
| InChI | InChI=1S/C16H9FN4OS3/c17-9-3-4-11-10(8-9)12(5-6-18-11)24-16-21-20-15(25-16)19-14(22)13-2-1-7-23-13/h1-8H,(H,19,20,22) |
| InChIKey | LYTXNCDJXHSDEQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|