C19H18N4O2S2 — CID 8520648
2-quinazolin-4-ylsulfanyl-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 8520648) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-quinazolin-4-ylsulfanyl-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-quinazolin-4-ylsulfanyl-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 8520648 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-quinazolin-4-ylsulfanyl-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1ncnc2ccccc12)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H18N4O2S2/c24-17(12-27-18-14-4-1-2-5-15(14)20-13-21-18)22-7-9-23(10-8-22)19(25)16-6-3-11-26-16/h1-6,11,13H,7-10,12H2 |
| InChIKey | GLOIGLJBILPNMG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |