C20H20N4O3S2 — CID 2652588
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-quinazolin-4-ylsulfanylethanone (PubChem CID 2652588) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-quinazolin-4-ylsulfanylethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-quinazolin-4-ylsulfanylethanone |
|---|---|
| PubChem CID | 2652588 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-quinazolin-4-ylsulfanylethanone |
| SMILES | O=C(CSc1ncnc2ccccc12)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N4O3S2/c25-19(14-28-20-17-8-4-5-9-18(17)21-15-22-20)23-10-12-24(13-11-23)29(26,27)16-6-2-1-3-7-16/h1-9,15H,10-14H2 |
| InChIKey | WVEKTGLDYHWAHR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |