C18H12N4OS — CID 134011955
N-(5-phenyl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide (PubChem CID 134011955) has the molecular formula C18H12N4OS and a molecular weight of 332.39 g/mol. Its IUPAC name is N-(5-phenyl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide.
| Compound Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 134011955 |
| Molecular Formula | C18H12N4OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1cccc2ncccc12 |
| InChI | InChI=1S/C18H12N4OS/c23-16(14-8-4-10-15-13(14)9-5-11-19-15)20-18-22-21-17(24-18)12-6-2-1-3-7-12/h1-11H,(H,20,22,23) |
| InChIKey | RUHKYOHNGBWPOT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |