C15H14N4OS — CID 24597682
N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide (PubChem CID 24597682) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide.
| Compound Name | N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 24597682 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)quinoline-5-carboxamide |
| SMILES | CC(C)c1nnc(NC(=O)c2cccc3ncccc23)s1 |
| InChI | InChI=1S/C15H14N4OS/c1-9(2)14-18-19-15(21-14)17-13(20)11-5-3-7-12-10(11)6-4-8-16-12/h3-9H,1-2H3,(H,17,19,20) |
| InChIKey | YAOBVZMNKWZLOL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |