C17H24BrNO — CID 104771448
3-(2-bromoethyl)-1-(3,4-dihydro-2H-chromen-4-ylmethyl)piperidine (PubChem CID 104771448) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-(3,4-dihydro-2H-chromen-4-ylmethyl)piperidine.
| Compound Name | 3-(2-bromoethyl)-1-(3,4-dihydro-2H-chromen-4-ylmethyl)piperidine |
|---|---|
| PubChem CID | 104771448 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(2-bromoethyl)-1-(3,4-dihydro-2H-chromen-4-ylmethyl)piperidine |
| SMILES | BrCCC1CCCN(CC2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C17H24BrNO/c18-9-7-14-4-3-10-19(12-14)13-15-8-11-20-17-6-2-1-5-16(15)17/h1-2,5-6,14-15H,3-4,7-13H2 |
| InChIKey | TUYWFMBGMAVFGF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|