C16H22BrNO — CID 114682381
4-bromo-1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylpiperidine (PubChem CID 114682381) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 4-bromo-1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylpiperidine.
| Compound Name | 4-bromo-1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylpiperidine |
|---|---|
| PubChem CID | 114682381 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-bromo-1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylpiperidine |
| SMILES | CC1CN(CC2CCOc3ccccc32)CCC1Br |
| InChI | InChI=1S/C16H22BrNO/c1-12-10-18(8-6-15(12)17)11-13-7-9-19-16-5-3-2-4-14(13)16/h2-5,12-13,15H,6-11H2,1H3 |
| InChIKey | ULQNZPMOQJZPBD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|