C13H24N2O — CID 104773457
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptan-3-amine (PubChem CID 104773457) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptan-3-amine.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptan-3-amine |
|---|---|
| PubChem CID | 104773457 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptan-3-amine |
| SMILES | CCCCC(CC)NC(C)c1ncc(C)o1 |
| InChI | InChI=1S/C13H24N2O/c1-5-7-8-12(6-2)15-11(4)13-14-9-10(3)16-13/h9,11-12,15H,5-8H2,1-4H3 |
| InChIKey | OQYGSSFOMCMZEG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |