C14H22BrN5O — CID 104776692
2-[4-(3-bromo-4-pyridinyl)piperazin-1-yl]-N'-hydroxypentanimidamide (PubChem CID 104776692) has the molecular formula C14H22BrN5O and a molecular weight of 356.27 g/mol. Its IUPAC name is 2-[4-(3-bromo-4-pyridinyl)piperazin-1-yl]-N'-hydroxypentanimidamide.
| Compound Name | 2-[4-(3-bromo-4-pyridinyl)piperazin-1-yl]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 104776692 |
| Molecular Formula | C14H22BrN5O |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[4-(3-bromo-4-pyridinyl)piperazin-1-yl]-N'-hydroxypentanimidamide |
| SMILES | CCCC(/C(N)=N/O)N1CCN(c2ccncc2Br)CC1 |
| InChI | InChI=1S/C14H22BrN5O/c1-2-3-13(14(16)18-21)20-8-6-19(7-9-20)12-4-5-17-10-11(12)15/h4-5,10,13,21H,2-3,6-9H2,1H3,(H2,16,18) |
| InChIKey | AELFPHBLABUQAX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|