C10H11BrN2 — CID 114412429
3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)pyridine (PubChem CID 114412429) has the molecular formula C10H11BrN2 and a molecular weight of 239.12 g/mol. Its IUPAC name is 3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)pyridine.
| Compound Name | 3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)pyridine |
|---|---|
| PubChem CID | 114412429 |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)pyridine |
| SMILES | Brc1cnccc1N1CC=CCC1 |
| InChI | InChI=1S/C10H11BrN2/c11-9-8-12-5-4-10(9)13-6-2-1-3-7-13/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | BIUNRKPZVQTIIU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|