C11H12N2O2 — CID 114410062
4-(3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carboxylic acid (PubChem CID 114410062) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114410062 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-yl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnccc1N1CC=CCC1 |
| InChI | InChI=1S/C11H12N2O2/c14-11(15)9-8-12-5-4-10(9)13-6-2-1-3-7-13/h1-2,4-5,8H,3,6-7H2,(H,14,15) |
| InChIKey | KSMSYZFOLGDNCB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|