C28H20O5 — CID 10478167
1,8-dihydroxy-10-(4-phenylmethoxybenzoyl)-10H-anthracen-9-one (PubChem CID 10478167) has the molecular formula C28H20O5 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1,8-dihydroxy-10-(4-phenylmethoxybenzoyl)-10H-anthracen-9-one.
| Compound Name | 1,8-dihydroxy-10-(4-phenylmethoxybenzoyl)-10H-anthracen-9-one |
|---|---|
| PubChem CID | 10478167 |
| Molecular Formula | C28H20O5 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1,8-dihydroxy-10-(4-phenylmethoxybenzoyl)-10H-anthracen-9-one |
| SMILES | O=C1c2c(O)cccc2C(C(=O)c2ccc(OCc3ccccc3)cc2)c2cccc(O)c21 |
| InChI | InChI=1S/C28H20O5/c29-22-10-4-8-20-24(21-9-5-11-23(30)26(21)28(32)25(20)22)27(31)18-12-14-19(15-13-18)33-16-17-6-2-1-3-7-17/h1-15,24,29-30H,16H2 |
| InChIKey | GPHWLXMGQIMYEA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |