C22H36N4O5 — CID 10478189
(E)-6-methyl-N-[(3S,7S,10S)-7-methyl-2,5,6,9-tetraoxo-3-propan-2-yl-1,4,8-triazacyclotridec-10-yl]hept-2-enamide (PubChem CID 10478189) has the molecular formula C22H36N4O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (E)-6-methyl-N-[(3S,7S,10S)-7-methyl-2,5,6,9-tetraoxo-3-propan-2-yl-1,4,8-triazacyclotridec-10-yl]hept-2-enamide.
| Compound Name | (E)-6-methyl-N-[(3S,7S,10S)-7-methyl-2,5,6,9-tetraoxo-3-propan-2-yl-1,4,8-triazacyclotridec-10-yl]hept-2-enamide |
|---|---|
| PubChem CID | 10478189 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (E)-6-methyl-N-[(3S,7S,10S)-7-methyl-2,5,6,9-tetraoxo-3-propan-2-yl-1,4,8-triazacyclotridec-10-yl]hept-2-enamide |
| SMILES | CC(C)CC/C=C/C(=O)N[C@H]1CCCNC(=O)[C@H](C(C)C)NC(=O)C(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C22H36N4O5/c1-13(2)9-6-7-11-17(27)25-16-10-8-12-23-21(30)18(14(3)4)26-22(31)19(28)15(5)24-20(16)29/h7,11,13-16,18H,6,8-10,12H2,1-5H3,(H,23,30)(H,24,29)(H,25,27)(H,26,31)/b11-7+/t15-,16-,18-/m0/s1 |
| InChIKey | AFJZBVRODZOFAV-YIPYENEMSA-N |
| XLogP | 0.59 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|