C24H40N4O5 — CID 163006970
(E,6S)-6-methyl-N-[(3R,7S,10S)-7-methyl-3-(2-methylpropyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide (PubChem CID 163006970) has the molecular formula C24H40N4O5 and a molecular weight of 464.61 g/mol. Its IUPAC name is (E,6S)-6-methyl-N-[(3R,7S,10S)-7-methyl-3-(2-methylpropyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide.
| Compound Name | (E,6S)-6-methyl-N-[(3R,7S,10S)-7-methyl-3-(2-methylpropyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide |
|---|---|
| PubChem CID | 163006970 |
| Molecular Formula | C24H40N4O5 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (E,6S)-6-methyl-N-[(3R,7S,10S)-7-methyl-3-(2-methylpropyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide |
| SMILES | CC[C@H](C)CC/C=C/C(=O)N[C@H]1CCCNC(=O)[C@@H](CC(C)C)NC(=O)C(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C24H40N4O5/c1-6-16(4)10-7-8-12-20(29)27-18-11-9-13-25-22(31)19(14-15(2)3)28-24(33)21(30)17(5)26-23(18)32/h8,12,15-19H,6-7,9-11,13-14H2,1-5H3,(H,25,31)(H,26,32)(H,27,29)(H,28,33)/b12-8+/t16-,17-,18-,19+/m0/s1 |
| InChIKey | YNIGBMUXBCZRNQ-GREMHARRSA-N |
| XLogP | 1.37 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|