C28H28N2O3 — CID 10478421
methyl 2-[3-[2-(dibenzylamino)ethyl]-1H-indol-2-yl]-3-oxopropanoate (PubChem CID 10478421) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl 2-[3-[2-(dibenzylamino)ethyl]-1H-indol-2-yl]-3-oxopropanoate.
| Compound Name | methyl 2-[3-[2-(dibenzylamino)ethyl]-1H-indol-2-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 10478421 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | methyl 2-[3-[2-(dibenzylamino)ethyl]-1H-indol-2-yl]-3-oxopropanoate |
| SMILES | COC(=O)C(C=O)c1[nH]c2ccccc2c1CCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H28N2O3/c1-33-28(32)25(20-31)27-24(23-14-8-9-15-26(23)29-27)16-17-30(18-21-10-4-2-5-11-21)19-22-12-6-3-7-13-22/h2-15,20,25,29H,16-19H2,1H3 |
| InChIKey | QCTHAWRLTJHIPW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|