About dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride
dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride (PubChem CID 117068877) has the molecular formula C18H25ClN2O4
and a molecular weight of 368.86 g/mol. Its IUPAC name is dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride.
Molecular Properties
| Compound Name | dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride |
| PubChem CID | 117068877 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride |
| SMILES | COC(=O)C(Cc1c(CCN(C)C)[nH]c2ccccc12)C(=O)OC.Cl |
| InChI | InChI=1S/C18H24N2O4.ClH/c1-20(2)10-9-16-13(12-7-5-6-8-15(12)19-16)11-14(17(21)23-3)18(22)24-4;/h5-8,14,19H,9-11H2,1-4H3;1H |
| InChIKey | PGNBRMHGDYMPMD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride?
The IUPAC name of dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride (CID 117068877) is dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride.
What is the SMILES notation for dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride?
The canonical SMILES for dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride is COC(=O)C(Cc1c(CCN(C)C)[nH]c2ccccc12)C(=O)OC.Cl.
What is the InChIKey of dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride?
The InChIKey is PGNBRMHGDYMPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4.ClH/c1-20(2)10-9-16-13(12-7-5-6-8-15(12)19-16)11-14(17(21)23-3)18(22)24-4;/h5-8,14,19H,9-11H2,1-4H3;1H.
What are the key properties of dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride?
dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride has a molecular weight of 368.86 g/mol, XLogP of 2.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[[2-[2-(dimethylamino)ethyl]-1H-indol-3-yl]methyl]propanedioate;hydrochloride is sourced from PubChem (CID 117068877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).