C20H28NO+ — CID 10478794
(4S)-3-methyl-4-propan-2-yl-2-[(1S)-1-propyl-4H-naphthalen-1-yl]-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 10478794) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is (4S)-3-methyl-4-propan-2-yl-2-[(1S)-1-propyl-4H-naphthalen-1-yl]-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | (4S)-3-methyl-4-propan-2-yl-2-[(1S)-1-propyl-4H-naphthalen-1-yl]-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 10478794 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (4S)-3-methyl-4-propan-2-yl-2-[(1S)-1-propyl-4H-naphthalen-1-yl]-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | CCC[C@]1(C2=[N+](C)[C@@H](C(C)C)CO2)C=CCc2ccccc21 |
| InChI | InChI=1S/C20H28NO/c1-5-12-20(19-21(4)18(14-22-19)15(2)3)13-8-10-16-9-6-7-11-17(16)20/h6-9,11,13,15,18H,5,10,12,14H2,1-4H3/q+1/t18-,20+/m1/s1 |
| InChIKey | IJRYBNYZCQQPCK-QUCCMNQESA-N |
| XLogP | 3.93 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|