C16H15N3O2 — CID 104788863
4-[1-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline (PubChem CID 104788863) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-[1-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline.
| Compound Name | 4-[1-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline |
|---|---|
| PubChem CID | 104788863 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-[1-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline |
| SMILES | Cc1occc1-c1noc(C2(c3ccc(N)cc3)CC2)n1 |
| InChI | InChI=1S/C16H15N3O2/c1-10-13(6-9-20-10)14-18-15(21-19-14)16(7-8-16)11-2-4-12(17)5-3-11/h2-6,9H,7-8,17H2,1H3 |
| InChIKey | ROFGNQFDNWGLIA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|