C13H9F2N3O2 — CID 104788963
2,4-difluoro-5-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 104788963) has the molecular formula C13H9F2N3O2 and a molecular weight of 277.23 g/mol. Its IUPAC name is 2,4-difluoro-5-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-difluoro-5-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 104788963 |
| Molecular Formula | C13H9F2N3O2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,4-difluoro-5-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1occc1-c1noc(-c2cc(N)c(F)cc2F)n1 |
| InChI | InChI=1S/C13H9F2N3O2/c1-6-7(2-3-19-6)12-17-13(20-18-12)8-4-11(16)10(15)5-9(8)14/h2-5H,16H2,1H3 |
| InChIKey | VMBBMKVTYQBELD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|