C12H12N2O2 — CID 104789293
2-(4-amino-3-pyridinyl)-1-(2-methylfuran-3-yl)ethanone (PubChem CID 104789293) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(4-amino-3-pyridinyl)-1-(2-methylfuran-3-yl)ethanone.
| Compound Name | 2-(4-amino-3-pyridinyl)-1-(2-methylfuran-3-yl)ethanone |
|---|---|
| PubChem CID | 104789293 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(4-amino-3-pyridinyl)-1-(2-methylfuran-3-yl)ethanone |
| SMILES | Cc1occc1C(=O)Cc1cnccc1N |
| InChI | InChI=1S/C12H12N2O2/c1-8-10(3-5-16-8)12(15)6-9-7-14-4-2-11(9)13/h2-5,7H,6H2,1H3,(H2,13,14) |
| InChIKey | ZCIAUTDSABZYNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |