C12H14N2O2 — CID 104800650
2-(4-amino-3-pyridinyl)-1-(3-methylfuran-2-yl)ethanol (PubChem CID 104800650) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(4-amino-3-pyridinyl)-1-(3-methylfuran-2-yl)ethanol.
| Compound Name | 2-(4-amino-3-pyridinyl)-1-(3-methylfuran-2-yl)ethanol |
|---|---|
| PubChem CID | 104800650 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-(4-amino-3-pyridinyl)-1-(3-methylfuran-2-yl)ethanol |
| SMILES | Cc1ccoc1C(O)Cc1cnccc1N |
| InChI | InChI=1S/C12H14N2O2/c1-8-3-5-16-12(8)11(15)6-9-7-14-4-2-10(9)13/h2-5,7,11,15H,6H2,1H3,(H2,13,14) |
| InChIKey | ZBIWWQLSJHHUFL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |