C12H19NO2 — CID 104789721
1-(2-methylfuran-3-yl)-3-(oxolan-2-yl)propan-1-amine (PubChem CID 104789721) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(2-methylfuran-3-yl)-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 1-(2-methylfuran-3-yl)-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 104789721 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(2-methylfuran-3-yl)-3-(oxolan-2-yl)propan-1-amine |
| SMILES | Cc1occc1C(N)CCC1CCCO1 |
| InChI | InChI=1S/C12H19NO2/c1-9-11(6-8-14-9)12(13)5-4-10-3-2-7-15-10/h6,8,10,12H,2-5,7,13H2,1H3 |
| InChIKey | LMLVGVLFXPCIAE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |