C14H23NO2 — CID 104993263
1-(2,5-dimethylfuran-3-yl)-4-(oxolan-2-yl)butan-1-amine (PubChem CID 104993263) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)-4-(oxolan-2-yl)butan-1-amine.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)-4-(oxolan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 104993263 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)-4-(oxolan-2-yl)butan-1-amine |
| SMILES | Cc1cc(C(N)CCCC2CCCO2)c(C)o1 |
| InChI | InChI=1S/C14H23NO2/c1-10-9-13(11(2)17-10)14(15)7-3-5-12-6-4-8-16-12/h9,12,14H,3-8,15H2,1-2H3 |
| InChIKey | LGNLVLYLSDAANU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |