C11H19NO — CID 104790058
N,2-dimethyl-1-(2-methylfuran-3-yl)butan-1-amine (PubChem CID 104790058) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N,2-dimethyl-1-(2-methylfuran-3-yl)butan-1-amine.
| Compound Name | N,2-dimethyl-1-(2-methylfuran-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 104790058 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N,2-dimethyl-1-(2-methylfuran-3-yl)butan-1-amine |
| SMILES | CCC(C)C(NC)c1ccoc1C |
| InChI | InChI=1S/C11H19NO/c1-5-8(2)11(12-4)10-6-7-13-9(10)3/h6-8,11-12H,5H2,1-4H3 |
| InChIKey | KKRSBDXPTZCXEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |