C13H20BrN — CID 105017381
1-(2-bromo-4-methylphenyl)-N,2-dimethylbutan-1-amine (PubChem CID 105017381) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(2-bromo-4-methylphenyl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105017381 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)c1ccc(C)cc1Br |
| InChI | InChI=1S/C13H20BrN/c1-5-10(3)13(15-4)11-7-6-9(2)8-12(11)14/h6-8,10,13,15H,5H2,1-4H3 |
| InChIKey | WMXBXXHWHQWAEV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |