C10H16BrNS — CID 79596424
1-(4-bromothiophen-3-yl)-N,2-dimethylbutan-1-amine (PubChem CID 79596424) has the molecular formula C10H16BrNS and a molecular weight of 262.22 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 79596424 |
| Molecular Formula | C10H16BrNS |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)c1cscc1Br |
| InChI | InChI=1S/C10H16BrNS/c1-4-7(2)10(12-3)8-5-13-6-9(8)11/h5-7,10,12H,4H2,1-3H3 |
| InChIKey | YBFMMANEYJMRHO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |