C9H14BrNS2 — CID 105166846
1-(4-bromothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 105166846) has the molecular formula C9H14BrNS2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 105166846 |
| Molecular Formula | C9H14BrNS2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CNC(CCSC)c1cscc1Br |
| InChI | InChI=1S/C9H14BrNS2/c1-11-9(3-4-12-2)7-5-13-6-8(7)10/h5-6,9,11H,3-4H2,1-2H3 |
| InChIKey | PLTZMCXNBVRUFJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |