C13H14BrNS — CID 79595314
1-(4-bromothiophen-3-yl)-N-methyl-2-phenylethanamine (PubChem CID 79595314) has the molecular formula C13H14BrNS and a molecular weight of 296.23 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N-methyl-2-phenylethanamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N-methyl-2-phenylethanamine |
|---|---|
| PubChem CID | 79595314 |
| Molecular Formula | C13H14BrNS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N-methyl-2-phenylethanamine |
| SMILES | CNC(Cc1ccccc1)c1cscc1Br |
| InChI | InChI=1S/C13H14BrNS/c1-15-13(11-8-16-9-12(11)14)7-10-5-3-2-4-6-10/h2-6,8-9,13,15H,7H2,1H3 |
| InChIKey | RSHMQPBQWDVRBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |