C10H17BrN2O2S — CID 105246270
[1-(4-bromothiophen-3-yl)-2,2-diethoxyethyl]hydrazine (PubChem CID 105246270) has the molecular formula C10H17BrN2O2S and a molecular weight of 309.23 g/mol. Its IUPAC name is [1-(4-bromothiophen-3-yl)-2,2-diethoxyethyl]hydrazine.
| Compound Name | [1-(4-bromothiophen-3-yl)-2,2-diethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105246270 |
| Molecular Formula | C10H17BrN2O2S |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [1-(4-bromothiophen-3-yl)-2,2-diethoxyethyl]hydrazine |
| SMILES | CCOC(OCC)C(NN)c1cscc1Br |
| InChI | InChI=1S/C10H17BrN2O2S/c1-3-14-10(15-4-2)9(13-12)7-5-16-6-8(7)11/h5-6,9-10,13H,3-4,12H2,1-2H3 |
| InChIKey | QKOUENJMRQCKST-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|