C13H24BrN3S — CID 105240804
1-(4-bromothiophen-3-yl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine (PubChem CID 105240804) has the molecular formula C13H24BrN3S and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 105240804 |
| Molecular Formula | C13H24BrN3S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine |
| SMILES | CCN(CC)C(C)(CC)C(NN)c1cscc1Br |
| InChI | InChI=1S/C13H24BrN3S/c1-5-13(4,17(6-2)7-3)12(16-15)10-8-18-9-11(10)14/h8-9,12,16H,5-7,15H2,1-4H3 |
| InChIKey | VZYYGLBSKBVZMM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|