C11H19BrN2S — CID 79602663
1-(4-bromothiophen-3-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 79602663) has the molecular formula C11H19BrN2S and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79602663 |
| Molecular Formula | C11H19BrN2S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)c1cscc1Br |
| InChI | InChI=1S/C11H19BrN2S/c1-3-14(4-2)6-5-11(13)9-7-15-8-10(9)12/h7-8,11H,3-6,13H2,1-2H3 |
| InChIKey | QFGPHZWEPDQPPE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |