C15H26N2O3 — CID 105246520
[2,2-diethoxy-1-(4-methoxy-2,5-dimethylphenyl)ethyl]hydrazine (PubChem CID 105246520) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is [2,2-diethoxy-1-(4-methoxy-2,5-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [2,2-diethoxy-1-(4-methoxy-2,5-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105246520 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [2,2-diethoxy-1-(4-methoxy-2,5-dimethylphenyl)ethyl]hydrazine |
| SMILES | CCOC(OCC)C(NN)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C15H26N2O3/c1-6-19-15(20-7-2)14(17-16)12-8-11(4)13(18-5)9-10(12)3/h8-9,14-15,17H,6-7,16H2,1-5H3 |
| InChIKey | BEPIHEYSINDNDJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|