C8H7BrF6N2S — CID 103312864
[1-(4-bromothiophen-3-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312864) has the molecular formula C8H7BrF6N2S and a molecular weight of 357.12 g/mol. Its IUPAC name is [1-(4-bromothiophen-3-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [1-(4-bromothiophen-3-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312864 |
| Molecular Formula | C8H7BrF6N2S |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | [1-(4-bromothiophen-3-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(c1cscc1Br)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7BrF6N2S/c9-4-2-18-1-3(4)5(17-16)6(7(10,11)12)8(13,14)15/h1-2,5-6,17H,16H2 |
| InChIKey | DPSUUPFNWXDWRU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|