C8H7BrF6N2O — CID 103312812
[1-(3-bromofuran-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312812) has the molecular formula C8H7BrF6N2O and a molecular weight of 341.05 g/mol. Its IUPAC name is [1-(3-bromofuran-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [1-(3-bromofuran-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312812 |
| Molecular Formula | C8H7BrF6N2O |
| Molecular Weight | 341.05 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | [1-(3-bromofuran-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(c1occc1Br)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7BrF6N2O/c9-3-1-2-18-5(3)4(17-16)6(7(10,11)12)8(13,14)15/h1-2,4,6,17H,16H2 |
| InChIKey | PZZKHZSYWXSZGQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|