C13H20BrNOS — CID 116761996
1-(4-bromothiophen-3-yl)-1-(1-ethoxycyclopentyl)-N-methylmethanamine (PubChem CID 116761996) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-1-(1-ethoxycyclopentyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-1-(1-ethoxycyclopentyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116761996 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-1-(1-ethoxycyclopentyl)-N-methylmethanamine |
| SMILES | CCOC1(C(NC)c2cscc2Br)CCCC1 |
| InChI | InChI=1S/C13H20BrNOS/c1-3-16-13(6-4-5-7-13)12(15-2)10-8-17-9-11(10)14/h8-9,12,15H,3-7H2,1-2H3 |
| InChIKey | AXMFBSGGTRFPET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |