C17H26BrN — CID 115862601
1-(2-bromo-4-methylphenyl)-1-(2-ethylcyclohexyl)-N-methylmethanamine (PubChem CID 115862601) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-1-(2-ethylcyclohexyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-4-methylphenyl)-1-(2-ethylcyclohexyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115862601 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-1-(2-ethylcyclohexyl)-N-methylmethanamine |
| SMILES | CCC1CCCCC1C(NC)c1ccc(C)cc1Br |
| InChI | InChI=1S/C17H26BrN/c1-4-13-7-5-6-8-14(13)17(19-3)15-10-9-12(2)11-16(15)18/h9-11,13-14,17,19H,4-8H2,1-3H3 |
| InChIKey | ZDWLKZQMWZOASS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |