C17H25FO2 — CID 104793164
4-ethyl-1-[(2-fluoro-3-methoxyphenyl)methyl]cycloheptan-1-ol (PubChem CID 104793164) has the molecular formula C17H25FO2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-ethyl-1-[(2-fluoro-3-methoxyphenyl)methyl]cycloheptan-1-ol.
| Compound Name | 4-ethyl-1-[(2-fluoro-3-methoxyphenyl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 104793164 |
| Molecular Formula | C17H25FO2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-ethyl-1-[(2-fluoro-3-methoxyphenyl)methyl]cycloheptan-1-ol |
| SMILES | CCC1CCCC(O)(Cc2cccc(OC)c2F)CC1 |
| InChI | InChI=1S/C17H25FO2/c1-3-13-6-5-10-17(19,11-9-13)12-14-7-4-8-15(20-2)16(14)18/h4,7-8,13,19H,3,5-6,9-12H2,1-2H3 |
| InChIKey | WIHMIHFVQYGBRP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |