C17H28FNO — CID 104794616
N-tert-butyl-2-[(2-fluoro-3-methoxyphenyl)methyl]pentan-1-amine (PubChem CID 104794616) has the molecular formula C17H28FNO and a molecular weight of 281.42 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-fluoro-3-methoxyphenyl)methyl]pentan-1-amine.
| Compound Name | N-tert-butyl-2-[(2-fluoro-3-methoxyphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 104794616 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | N-tert-butyl-2-[(2-fluoro-3-methoxyphenyl)methyl]pentan-1-amine |
| SMILES | CCCC(CNC(C)(C)C)Cc1cccc(OC)c1F |
| InChI | InChI=1S/C17H28FNO/c1-6-8-13(12-19-17(2,3)4)11-14-9-7-10-15(20-5)16(14)18/h7,9-10,13,19H,6,8,11-12H2,1-5H3 |
| InChIKey | XJQYABPKUWNBMZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |