C13H11BrF2N2 — CID 104797104
N-[(5-bromo-3-pyridinyl)methyl]-2,6-difluoro-3-methylaniline (PubChem CID 104797104) has the molecular formula C13H11BrF2N2 and a molecular weight of 313.15 g/mol. Its IUPAC name is N-[(5-bromo-3-pyridinyl)methyl]-2,6-difluoro-3-methylaniline.
| Compound Name | N-[(5-bromo-3-pyridinyl)methyl]-2,6-difluoro-3-methylaniline |
|---|---|
| PubChem CID | 104797104 |
| Molecular Formula | C13H11BrF2N2 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | N-[(5-bromo-3-pyridinyl)methyl]-2,6-difluoro-3-methylaniline |
| SMILES | Cc1ccc(F)c(NCc2cncc(Br)c2)c1F |
| InChI | InChI=1S/C13H11BrF2N2/c1-8-2-3-11(15)13(12(8)16)18-6-9-4-10(14)7-17-5-9/h2-5,7,18H,6H2,1H3 |
| InChIKey | ZUPBWUIQERWJLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |