C15H14BrN3O — CID 104797226
7-amino-2-[(5-bromo-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 104797226) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 7-amino-2-[(5-bromo-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-amino-2-[(5-bromo-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 104797226 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 7-amino-2-[(5-bromo-3-pyridinyl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Nc1ccc2c(c1)C(=O)N(Cc1cncc(Br)c1)CC2 |
| InChI | InChI=1S/C15H14BrN3O/c16-12-5-10(7-18-8-12)9-19-4-3-11-1-2-13(17)6-14(11)15(19)20/h1-2,5-8H,3-4,9,17H2 |
| InChIKey | JZLBFLQRRGGRGN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|