C15H16IN3O — CID 79787613
2-[(1-ethylpyrazol-4-yl)methyl]-7-iodo-3,4-dihydroisoquinolin-1-one (PubChem CID 79787613) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)methyl]-7-iodo-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)methyl]-7-iodo-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 79787613 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)methyl]-7-iodo-3,4-dihydroisoquinolin-1-one |
| SMILES | CCn1cc(CN2CCc3ccc(I)cc3C2=O)cn1 |
| InChI | InChI=1S/C15H16IN3O/c1-2-19-10-11(8-17-19)9-18-6-5-12-3-4-13(16)7-14(12)15(18)20/h3-4,7-8,10H,2,5-6,9H2,1H3 |
| InChIKey | BEONVOFVQADPAI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|