C12H17BrN4O — CID 104797630
1-[(5-bromo-3-pyridinyl)methyl]-N'-hydroxypiperidine-2-carboximidamide (PubChem CID 104797630) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-[(5-bromo-3-pyridinyl)methyl]-N'-hydroxypiperidine-2-carboximidamide.
| Compound Name | 1-[(5-bromo-3-pyridinyl)methyl]-N'-hydroxypiperidine-2-carboximidamide |
|---|---|
| PubChem CID | 104797630 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-[(5-bromo-3-pyridinyl)methyl]-N'-hydroxypiperidine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CCCCN1Cc1cncc(Br)c1 |
| InChI | InChI=1S/C12H17BrN4O/c13-10-5-9(6-15-7-10)8-17-4-2-1-3-11(17)12(14)16-18/h5-7,11,18H,1-4,8H2,(H2,14,16) |
| InChIKey | NVLBJFQBQLZDFZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|