C12H18N4O — CID 77041710
N'-hydroxy-1-(pyridin-3-ylmethyl)piperidine-2-carboximidamide (PubChem CID 77041710) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is N'-hydroxy-1-(pyridin-3-ylmethyl)piperidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-(pyridin-3-ylmethyl)piperidine-2-carboximidamide |
|---|---|
| PubChem CID | 77041710 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N'-hydroxy-1-(pyridin-3-ylmethyl)piperidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCCN1Cc1cccnc1 |
| InChI | InChI=1S/C12H18N4O/c13-12(15-17)11-5-1-2-7-16(11)9-10-4-3-6-14-8-10/h3-4,6,8,11,17H,1-2,5,7,9H2,(H2,13,15) |
| InChIKey | HKTUQEHJTKNUAW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|