C16H14BrNO2 — CID 104799040
2-(5-bromo-3-pyridinyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanone (PubChem CID 104799040) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanone.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanone |
|---|---|
| PubChem CID | 104799040 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanone |
| SMILES | O=C(Cc1cncc(Br)c1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H14BrNO2/c17-14-5-11(8-18-9-14)6-15(19)13-7-12-3-1-2-4-16(12)20-10-13/h1-5,8-9,13H,6-7,10H2 |
| InChIKey | ZXESRLRRBBMLCJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |