C14H13BrN2O4 — CID 104800203
2-amino-5-[(5-bromo-3-pyridinyl)methoxy]-4-methoxybenzoic acid (PubChem CID 104800203) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is 2-amino-5-[(5-bromo-3-pyridinyl)methoxy]-4-methoxybenzoic acid.
| Compound Name | 2-amino-5-[(5-bromo-3-pyridinyl)methoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 104800203 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-amino-5-[(5-bromo-3-pyridinyl)methoxy]-4-methoxybenzoic acid |
| SMILES | COc1cc(N)c(C(=O)O)cc1OCc1cncc(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O4/c1-20-12-4-11(16)10(14(18)19)3-13(12)21-7-8-2-9(15)6-17-5-8/h2-6H,7,16H2,1H3,(H,18,19) |
| InChIKey | KTSODBPKSPBTDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|