C30H28N4O2 — CID 10480115
tert-butyl N-(4-amino-5-phenyl-3-pyridinyl)-N-[[4-(2-cyanophenyl)phenyl]methyl]carbamate (PubChem CID 10480115) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is tert-butyl N-(4-amino-5-phenyl-3-pyridinyl)-N-[[4-(2-cyanophenyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(4-amino-5-phenyl-3-pyridinyl)-N-[[4-(2-cyanophenyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 10480115 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | tert-butyl N-(4-amino-5-phenyl-3-pyridinyl)-N-[[4-(2-cyanophenyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(-c2ccccc2C#N)cc1)c1cncc(-c2ccccc2)c1N |
| InChI | InChI=1S/C30H28N4O2/c1-30(2,3)36-29(35)34(27-19-33-18-26(28(27)32)22-9-5-4-6-10-22)20-21-13-15-23(16-14-21)25-12-8-7-11-24(25)17-31/h4-16,18-19H,20H2,1-3H3,(H2,32,33) |
| InChIKey | VEXAJBDUUALDGO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |