C17H18BrN3 — CID 104801171
N-[[1-[(5-bromo-3-pyridinyl)methyl]indol-4-yl]methyl]ethanamine (PubChem CID 104801171) has the molecular formula C17H18BrN3 and a molecular weight of 344.26 g/mol. Its IUPAC name is N-[[1-[(5-bromo-3-pyridinyl)methyl]indol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-bromo-3-pyridinyl)methyl]indol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 104801171 |
| Molecular Formula | C17H18BrN3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[[1-[(5-bromo-3-pyridinyl)methyl]indol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cccc2c1ccn2Cc1cncc(Br)c1 |
| InChI | InChI=1S/C17H18BrN3/c1-2-19-10-14-4-3-5-17-16(14)6-7-21(17)12-13-8-15(18)11-20-9-13/h3-9,11,19H,2,10,12H2,1H3 |
| InChIKey | JMSKIHHFBUWCSG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |