C17H19N3 — CID 102878789
2-[1-[(5-methyl-3-pyridinyl)methyl]indol-4-yl]ethanamine (PubChem CID 102878789) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[1-[(5-methyl-3-pyridinyl)methyl]indol-4-yl]ethanamine.
| Compound Name | 2-[1-[(5-methyl-3-pyridinyl)methyl]indol-4-yl]ethanamine |
|---|---|
| PubChem CID | 102878789 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[1-[(5-methyl-3-pyridinyl)methyl]indol-4-yl]ethanamine |
| SMILES | Cc1cncc(Cn2ccc3c(CCN)cccc32)c1 |
| InChI | InChI=1S/C17H19N3/c1-13-9-14(11-19-10-13)12-20-8-6-16-15(5-7-18)3-2-4-17(16)20/h2-4,6,8-11H,5,7,12,18H2,1H3 |
| InChIKey | BPEGNDIEUUXRTO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|