C16H14F2N2 — CID 82920553
[1-[(3,4-difluorophenyl)methyl]indol-4-yl]methanamine (PubChem CID 82920553) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is [1-[(3,4-difluorophenyl)methyl]indol-4-yl]methanamine.
| Compound Name | [1-[(3,4-difluorophenyl)methyl]indol-4-yl]methanamine |
|---|---|
| PubChem CID | 82920553 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [1-[(3,4-difluorophenyl)methyl]indol-4-yl]methanamine |
| SMILES | NCc1cccc2c1ccn2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H14F2N2/c17-14-5-4-11(8-15(14)18)10-20-7-6-13-12(9-19)2-1-3-16(13)20/h1-8H,9-10,19H2 |
| InChIKey | OSZRTIHWUUQZNP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |