C16H13BrF2N2 — CID 106265006
[1-[(3-bromo-2,6-difluorophenyl)methyl]indol-4-yl]methanamine (PubChem CID 106265006) has the molecular formula C16H13BrF2N2 and a molecular weight of 351.19 g/mol. Its IUPAC name is [1-[(3-bromo-2,6-difluorophenyl)methyl]indol-4-yl]methanamine.
| Compound Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]indol-4-yl]methanamine |
|---|---|
| PubChem CID | 106265006 |
| Molecular Formula | C16H13BrF2N2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]indol-4-yl]methanamine |
| SMILES | NCc1cccc2c1ccn2Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H13BrF2N2/c17-13-4-5-14(18)12(16(13)19)9-21-7-6-11-10(8-20)2-1-3-15(11)21/h1-7H,8-9,20H2 |
| InChIKey | LVTFSILTAMLTMW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|